C10H14FN3O2S — CID 95400234
5-fluoro-N-[(3S)-piperidin-3-yl]pyridine-3-sulfonamide (PubChem CID 95400234) has the molecular formula C10H14FN3O2S and a molecular weight of 259.31 g/mol. Its IUPAC name is 5-fluoro-N-[(3S)-piperidin-3-yl]pyridine-3-sulfonamide.
| Compound Name | 5-fluoro-N-[(3S)-piperidin-3-yl]pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 95400234 |
| Molecular Formula | C10H14FN3O2S |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.08 |
| IUPAC Name | 5-fluoro-N-[(3S)-piperidin-3-yl]pyridine-3-sulfonamide |
| SMILES | O=S(=O)(N[C@H]1CCCNC1)c1cncc(F)c1 |
| InChI | InChI=1S/C10H14FN3O2S/c11-8-4-10(7-13-5-8)17(15,16)14-9-2-1-3-12-6-9/h4-5,7,9,12,14H,1-3,6H2/t9-/m0/s1 |
| InChIKey | DIOSIVRGGBNVGJ-VIFPVBQESA-N |
| XLogP | 0.25 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |