C11H22N4O3 — CID 155384555
N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-3-(3-methyldiazirin-3-yl)propanamide (PubChem CID 155384555) has the molecular formula C11H22N4O3 and a molecular weight of 258.32 g/mol. Its IUPAC name is N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-3-(3-methyldiazirin-3-yl)propanamide.
| Compound Name | N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-3-(3-methyldiazirin-3-yl)propanamide |
|---|---|
| PubChem CID | 155384555 |
| Molecular Formula | C11H22N4O3 |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.17 |
| IUPAC Name | N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-3-(3-methyldiazirin-3-yl)propanamide |
| SMILES | CC1(CCC(=O)NCCOCCOCCN)N=N1 |
| InChI | InChI=1S/C11H22N4O3/c1-11(14-15-11)3-2-10(16)13-5-7-18-9-8-17-6-4-12/h2-9,12H2,1H3,(H,13,16) |
| InChIKey | VTNGHBVPNLNWOW-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 98.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|