C12H19NO5S2 — CID 58371253
(2,5-dioxopyrrolidin-1-yl) 2-(5-tritiopentyldisulfanyl)ethyl carbonate (PubChem CID 58371253) has the molecular formula C12H19NO5S2 and a molecular weight of 323.43 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 2-(5-tritiopentyldisulfanyl)ethyl carbonate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 2-(5-tritiopentyldisulfanyl)ethyl carbonate |
|---|---|
| PubChem CID | 58371253 |
| Molecular Formula | C12H19NO5S2 |
| Molecular Weight | 323.43 g/mol |
| Exact Mass | 323.08 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 2-(5-tritiopentyldisulfanyl)ethyl carbonate |
| SMILES | [3H]CCCCCSSCCOC(=O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C12H19NO5S2/c1-2-3-4-8-19-20-9-7-17-12(16)18-13-10(14)5-6-11(13)15/h2-9H2,1H3/i1T |
| InChIKey | MZGMVLHSSLADDI-CNRUNOGKSA-N |
| XLogP | 2.78 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.43 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|