C10H15MtN2O5S2- — CID 58371256
(2,5-dioxopyrrolidin-1-yl) 2-[2-(methanidylamino)ethyldisulfanyl]ethyl carbonate;meitnerium (PubChem CID 58371256) has the molecular formula C10H15MtN2O5S2- and a molecular weight of 585.37 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 2-[2-(methanidylamino)ethyldisulfanyl]ethyl carbonate;meitnerium.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 2-[2-(methanidylamino)ethyldisulfanyl]ethyl carbonate;meitnerium |
|---|---|
| PubChem CID | 58371256 |
| Molecular Formula | C10H15MtN2O5S2- |
| Molecular Weight | 585.37 g/mol |
| Exact Mass | 585.20 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 2-[2-(methanidylamino)ethyldisulfanyl]ethyl carbonate;meitnerium |
| SMILES | [CH2-]NCCSSCCOC(=O)ON1C(=O)CCC1=O.[Mt] |
| InChI | InChI=1S/C10H15N2O5S2.Mt/c1-11-4-6-18-19-7-5-16-10(15)17-12-8(13)2-3-9(12)14;/h11H,1-7H2;/q-1; |
| InChIKey | UESFPJCXXOBZOB-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.37 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|