C28H27NO6S2 — CID 58608043
(2,5-dioxopyrrolidin-1-yl) 2-(2-trityloxyethyldisulfanyl)ethyl carbonate (PubChem CID 58608043) has the molecular formula C28H27NO6S2 and a molecular weight of 537.66 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 2-(2-trityloxyethyldisulfanyl)ethyl carbonate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 2-(2-trityloxyethyldisulfanyl)ethyl carbonate |
|---|---|
| PubChem CID | 58608043 |
| Molecular Formula | C28H27NO6S2 |
| Molecular Weight | 537.66 g/mol |
| Exact Mass | 537.13 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 2-(2-trityloxyethyldisulfanyl)ethyl carbonate |
| SMILES | O=C(OCCSSCCOC(c1ccccc1)(c1ccccc1)c1ccccc1)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C28H27NO6S2/c30-25-16-17-26(31)29(25)35-27(32)33-18-20-36-37-21-19-34-28(22-10-4-1-5-11-22,23-12-6-2-7-13-23)24-14-8-3-9-15-24/h1-15H,16-21H2 |
| InChIKey | PHRFTHMRSVPCSR-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.66 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|