About (2,5-dioxopyrrolidin-1-yl) 4-(4-hydroxybutyldisulfanyl)butanoate
(2,5-dioxopyrrolidin-1-yl) 4-(4-hydroxybutyldisulfanyl)butanoate (PubChem CID 166945532) has the molecular formula C12H19NO5S2
and a molecular weight of 321.42 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 4-(4-hydroxybutyldisulfanyl)butanoate.
Molecular Properties
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 4-(4-hydroxybutyldisulfanyl)butanoate |
| PubChem CID | 166945532 |
| Molecular Formula | C12H19NO5S2 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.07 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 4-(4-hydroxybutyldisulfanyl)butanoate |
| SMILES | O=C(CCCSSCCCCO)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C12H19NO5S2/c14-7-1-2-8-19-20-9-3-4-12(17)18-13-10(15)5-6-11(13)16/h14H,1-9H2 |
| InChIKey | ONEUDSRHSZIJPF-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze (2,5-dioxopyrrolidin-1-yl) 4-(4-hydroxybutyldisulfanyl)butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,5-dioxopyrrolidin-1-yl) 4-(4-hydroxybutyldisulfanyl)butanoate?
The IUPAC name of (2,5-dioxopyrrolidin-1-yl) 4-(4-hydroxybutyldisulfanyl)butanoate (CID 166945532) is (2,5-dioxopyrrolidin-1-yl) 4-(4-hydroxybutyldisulfanyl)butanoate.
What is the SMILES notation for (2,5-dioxopyrrolidin-1-yl) 4-(4-hydroxybutyldisulfanyl)butanoate?
The canonical SMILES for (2,5-dioxopyrrolidin-1-yl) 4-(4-hydroxybutyldisulfanyl)butanoate is O=C(CCCSSCCCCO)ON1C(=O)CCC1=O.
What is the InChIKey of (2,5-dioxopyrrolidin-1-yl) 4-(4-hydroxybutyldisulfanyl)butanoate?
The InChIKey is ONEUDSRHSZIJPF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19NO5S2/c14-7-1-2-8-19-20-9-3-4-12(17)18-13-10(15)5-6-11(13)16/h14H,1-9H2.
What are the key properties of (2,5-dioxopyrrolidin-1-yl) 4-(4-hydroxybutyldisulfanyl)butanoate?
(2,5-dioxopyrrolidin-1-yl) 4-(4-hydroxybutyldisulfanyl)butanoate has a molecular weight of 321.42 g/mol, XLogP of 1.53, 10 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (2,5-dioxopyrrolidin-1-yl) 4-(4-hydroxybutyldisulfanyl)butanoate is sourced from PubChem (CID 166945532), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).