C9H10N2O7 — CID 88868762
(2,5-dioxopyrrolidin-1-yl) (2-hydroxy-5-oxopyrrolidin-1-yl) carbonate (PubChem CID 88868762) has the molecular formula C9H10N2O7 and a molecular weight of 258.19 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) (2-hydroxy-5-oxopyrrolidin-1-yl) carbonate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) (2-hydroxy-5-oxopyrrolidin-1-yl) carbonate |
|---|---|
| PubChem CID | 88868762 |
| Molecular Formula | C9H10N2O7 |
| Molecular Weight | 258.19 g/mol |
| Exact Mass | 258.05 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) (2-hydroxy-5-oxopyrrolidin-1-yl) carbonate |
| SMILES | O=C(ON1C(=O)CCC1=O)ON1C(=O)CCC1O |
| InChI | InChI=1S/C9H10N2O7/c12-5-1-2-6(13)10(5)17-9(16)18-11-7(14)3-4-8(11)15/h5,12H,1-4H2 |
| InChIKey | PREFWHIJLVJBBF-UHFFFAOYSA-N |
| XLogP | -0.94 |
| TPSA | 113.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.19 |
| LogP ≤ 5 | -0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|