C8H11NO5 — CID 89325456
[(2S)-2-hydroxy-5-oxopyrrolidin-1-yl] 4-oxobutanoate (PubChem CID 89325456) has the molecular formula C8H11NO5 and a molecular weight of 201.18 g/mol. Its IUPAC name is [(2S)-2-hydroxy-5-oxopyrrolidin-1-yl] 4-oxobutanoate.
| Compound Name | [(2S)-2-hydroxy-5-oxopyrrolidin-1-yl] 4-oxobutanoate |
|---|---|
| PubChem CID | 89325456 |
| Molecular Formula | C8H11NO5 |
| Molecular Weight | 201.18 g/mol |
| Exact Mass | 201.06 |
| IUPAC Name | [(2S)-2-hydroxy-5-oxopyrrolidin-1-yl] 4-oxobutanoate |
| SMILES | O=CCCC(=O)ON1C(=O)CC[C@@H]1O |
| InChI | InChI=1S/C8H11NO5/c10-5-1-2-8(13)14-9-6(11)3-4-7(9)12/h5-6,11H,1-4H2/t6-/m0/s1 |
| InChIKey | MDESAHHKBPPZFC-LURJTMIESA-N |
| XLogP | -0.64 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.18 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|