C13H14N2O4S2 — CID 153021661
(2-hydroxy-5-oxopyrrolidin-1-yl) 3-(1-azacyclohepta-2,7-dien-5-yn-2-yldisulfanyl)propanoate (PubChem CID 153021661) has the molecular formula C13H14N2O4S2 and a molecular weight of 326.40 g/mol. Its IUPAC name is (2-hydroxy-5-oxopyrrolidin-1-yl) 3-(1-azacyclohepta-2,7-dien-5-yn-2-yldisulfanyl)propanoate.
| Compound Name | (2-hydroxy-5-oxopyrrolidin-1-yl) 3-(1-azacyclohepta-2,7-dien-5-yn-2-yldisulfanyl)propanoate |
|---|---|
| PubChem CID | 153021661 |
| Molecular Formula | C13H14N2O4S2 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.04 |
| IUPAC Name | (2-hydroxy-5-oxopyrrolidin-1-yl) 3-(1-azacyclohepta-2,7-dien-5-yn-2-yldisulfanyl)propanoate |
| SMILES | O=C(CCSSC1=CCC#CC=N1)ON1C(=O)CCC1O |
| InChI | InChI=1S/C13H14N2O4S2/c16-11-5-6-12(17)15(11)19-13(18)7-9-20-21-10-4-2-1-3-8-14-10/h4,8,11,16H,2,5-7,9H2 |
| InChIKey | VCBBUTRGFYMLHY-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 79.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|