C24H23N3O12 — CID 134502036
(2-hydroxy-5-oxopyrrolidin-1-yl) 2-[3,5-bis[2-(2,5-dioxopyrrolidin-1-yl)oxy-2-oxoethyl]phenyl]acetate (PubChem CID 134502036) has the molecular formula C24H23N3O12 and a molecular weight of 545.46 g/mol. Its IUPAC name is (2-hydroxy-5-oxopyrrolidin-1-yl) 2-[3,5-bis[2-(2,5-dioxopyrrolidin-1-yl)oxy-2-oxoethyl]phenyl]acetate.
| Compound Name | (2-hydroxy-5-oxopyrrolidin-1-yl) 2-[3,5-bis[2-(2,5-dioxopyrrolidin-1-yl)oxy-2-oxoethyl]phenyl]acetate |
|---|---|
| PubChem CID | 134502036 |
| Molecular Formula | C24H23N3O12 |
| Molecular Weight | 545.46 g/mol |
| Exact Mass | 545.13 |
| IUPAC Name | (2-hydroxy-5-oxopyrrolidin-1-yl) 2-[3,5-bis[2-(2,5-dioxopyrrolidin-1-yl)oxy-2-oxoethyl]phenyl]acetate |
| SMILES | O=C(Cc1cc(CC(=O)ON2C(=O)CCC2=O)cc(CC(=O)ON2C(=O)CCC2O)c1)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C24H23N3O12/c28-16-1-2-17(29)25(16)37-22(34)10-13-7-14(11-23(35)38-26-18(30)3-4-19(26)31)9-15(8-13)12-24(36)39-27-20(32)5-6-21(27)33/h7-9,16,28H,1-6,10-12H2 |
| InChIKey | MSYWEBQEACZMPL-UHFFFAOYSA-N |
| XLogP | -1.07 |
| TPSA | 194.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.46 |
| LogP ≤ 5 | -1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|