C7H10INO5 — CID 156562908
(2-hydroxy-5-oxopyrrolidin-1-yl) 2-iodoethyl carbonate (PubChem CID 156562908) has the molecular formula C7H10INO5 and a molecular weight of 315.06 g/mol. Its IUPAC name is (2-hydroxy-5-oxopyrrolidin-1-yl) 2-iodoethyl carbonate.
| Compound Name | (2-hydroxy-5-oxopyrrolidin-1-yl) 2-iodoethyl carbonate |
|---|---|
| PubChem CID | 156562908 |
| Molecular Formula | C7H10INO5 |
| Molecular Weight | 315.06 g/mol |
| Exact Mass | 314.96 |
| IUPAC Name | (2-hydroxy-5-oxopyrrolidin-1-yl) 2-iodoethyl carbonate |
| SMILES | O=C(OCCI)ON1C(=O)CCC1O |
| InChI | InChI=1S/C7H10INO5/c8-3-4-13-7(12)14-9-5(10)1-2-6(9)11/h5,10H,1-4H2 |
| InChIKey | QJEJLMVVKPHYGX-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.06 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|