C11H12N2O6S — CID 178016929
(2-hydroxy-5-oxopyrrolidin-1-yl) 4-sulfamoylbenzoate (PubChem CID 178016929) has the molecular formula C11H12N2O6S and a molecular weight of 300.29 g/mol. Its IUPAC name is (2-hydroxy-5-oxopyrrolidin-1-yl) 4-sulfamoylbenzoate.
| Compound Name | (2-hydroxy-5-oxopyrrolidin-1-yl) 4-sulfamoylbenzoate |
|---|---|
| PubChem CID | 178016929 |
| Molecular Formula | C11H12N2O6S |
| Molecular Weight | 300.29 g/mol |
| Exact Mass | 300.04 |
| IUPAC Name | (2-hydroxy-5-oxopyrrolidin-1-yl) 4-sulfamoylbenzoate |
| SMILES | NS(=O)(=O)c1ccc(C(=O)ON2C(=O)CCC2O)cc1 |
| InChI | InChI=1S/C11H12N2O6S/c12-20(17,18)8-3-1-7(2-4-8)11(16)19-13-9(14)5-6-10(13)15/h1-4,9,14H,5-6H2,(H2,12,17,18) |
| InChIKey | MTXAEPLPBCJURJ-UHFFFAOYSA-N |
| XLogP | -0.65 |
| TPSA | 127.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.29 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |