C13H14FNO7S — CID 166157782
(2-hydroxy-5-oxopyrrolidin-1-yl) 2-(4-fluorosulfonyloxyphenyl)propanoate (PubChem CID 166157782) has the molecular formula C13H14FNO7S and a molecular weight of 347.32 g/mol. Its IUPAC name is (2-hydroxy-5-oxopyrrolidin-1-yl) 2-(4-fluorosulfonyloxyphenyl)propanoate.
| Compound Name | (2-hydroxy-5-oxopyrrolidin-1-yl) 2-(4-fluorosulfonyloxyphenyl)propanoate |
|---|---|
| PubChem CID | 166157782 |
| Molecular Formula | C13H14FNO7S |
| Molecular Weight | 347.32 g/mol |
| Exact Mass | 347.05 |
| IUPAC Name | (2-hydroxy-5-oxopyrrolidin-1-yl) 2-(4-fluorosulfonyloxyphenyl)propanoate |
| SMILES | CC(C(=O)ON1C(=O)CCC1O)c1ccc(OS(=O)(=O)F)cc1 |
| InChI | InChI=1S/C13H14FNO7S/c1-8(13(18)21-15-11(16)6-7-12(15)17)9-2-4-10(5-3-9)22-23(14,19)20/h2-5,8,11,16H,6-7H2,1H3 |
| InChIKey | RDPVVUFBNXGOOK-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 110.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.32 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |