C6H8INO4 — CID 148605388
(2-hydroxy-5-oxopyrrolidin-1-yl) 2-iodoacetate (PubChem CID 148605388) has the molecular formula C6H8INO4 and a molecular weight of 285.04 g/mol. Its IUPAC name is (2-hydroxy-5-oxopyrrolidin-1-yl) 2-iodoacetate.
| Compound Name | (2-hydroxy-5-oxopyrrolidin-1-yl) 2-iodoacetate |
|---|---|
| PubChem CID | 148605388 |
| Molecular Formula | C6H8INO4 |
| Molecular Weight | 285.04 g/mol |
| Exact Mass | 284.95 |
| IUPAC Name | (2-hydroxy-5-oxopyrrolidin-1-yl) 2-iodoacetate |
| SMILES | O=C(CI)ON1C(=O)CCC1O |
| InChI | InChI=1S/C6H8INO4/c7-3-6(11)12-8-4(9)1-2-5(8)10/h4,9H,1-3H2 |
| InChIKey | NDHMPKAZHZPSNU-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.04 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|