C11H16N2O4 — CID 126576248
(2-hydroxy-5-oxopyrrolidin-1-yl) N-hex-5-ynylcarbamate (PubChem CID 126576248) has the molecular formula C11H16N2O4 and a molecular weight of 240.26 g/mol. Its IUPAC name is (2-hydroxy-5-oxopyrrolidin-1-yl) N-hex-5-ynylcarbamate.
| Compound Name | (2-hydroxy-5-oxopyrrolidin-1-yl) N-hex-5-ynylcarbamate |
|---|---|
| PubChem CID | 126576248 |
| Molecular Formula | C11H16N2O4 |
| Molecular Weight | 240.26 g/mol |
| Exact Mass | 240.11 |
| IUPAC Name | (2-hydroxy-5-oxopyrrolidin-1-yl) N-hex-5-ynylcarbamate |
| SMILES | C#CCCCCNC(=O)ON1C(=O)CCC1O |
| InChI | InChI=1S/C11H16N2O4/c1-2-3-4-5-8-12-11(16)17-13-9(14)6-7-10(13)15/h1,9,14H,3-8H2,(H,12,16) |
| InChIKey | JQGXYFFAETWQPU-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.26 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|