C18H18N2O6 — CID 153387061
(2-hydroxy-5-oxopyrrolidin-1-yl) 4-[3-(2,5-dioxopyrrol-1-yl)phenyl]butanoate (PubChem CID 153387061) has the molecular formula C18H18N2O6 and a molecular weight of 358.35 g/mol. Its IUPAC name is (2-hydroxy-5-oxopyrrolidin-1-yl) 4-[3-(2,5-dioxopyrrol-1-yl)phenyl]butanoate.
| Compound Name | (2-hydroxy-5-oxopyrrolidin-1-yl) 4-[3-(2,5-dioxopyrrol-1-yl)phenyl]butanoate |
|---|---|
| PubChem CID | 153387061 |
| Molecular Formula | C18H18N2O6 |
| Molecular Weight | 358.35 g/mol |
| Exact Mass | 358.12 |
| IUPAC Name | (2-hydroxy-5-oxopyrrolidin-1-yl) 4-[3-(2,5-dioxopyrrol-1-yl)phenyl]butanoate |
| SMILES | O=C(CCCc1cccc(N2C(=O)C=CC2=O)c1)ON1C(=O)CCC1O |
| InChI | InChI=1S/C18H18N2O6/c21-14-7-8-15(22)19(14)13-5-1-3-12(11-13)4-2-6-18(25)26-20-16(23)9-10-17(20)24/h1,3,5,7-8,11,16,23H,2,4,6,9-10H2 |
| InChIKey | FJCNYZORLBPNHN-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 104.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.35 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|