C15H16N2O6 — CID 146560988
(2-hydroxy-5-oxopyrrolidin-1-yl) [4-(2-methylprop-2-enoylamino)phenyl] carbonate (PubChem CID 146560988) has the molecular formula C15H16N2O6 and a molecular weight of 320.30 g/mol. Its IUPAC name is (2-hydroxy-5-oxopyrrolidin-1-yl) [4-(2-methylprop-2-enoylamino)phenyl] carbonate.
| Compound Name | (2-hydroxy-5-oxopyrrolidin-1-yl) [4-(2-methylprop-2-enoylamino)phenyl] carbonate |
|---|---|
| PubChem CID | 146560988 |
| Molecular Formula | C15H16N2O6 |
| Molecular Weight | 320.30 g/mol |
| Exact Mass | 320.10 |
| IUPAC Name | (2-hydroxy-5-oxopyrrolidin-1-yl) [4-(2-methylprop-2-enoylamino)phenyl] carbonate |
| SMILES | C=C(C)C(=O)Nc1ccc(OC(=O)ON2C(=O)CCC2O)cc1 |
| InChI | InChI=1S/C15H16N2O6/c1-9(2)14(20)16-10-3-5-11(6-4-10)22-15(21)23-17-12(18)7-8-13(17)19/h3-6,12,18H,1,7-8H2,2H3,(H,16,20) |
| InChIKey | OWYROTCKRAWGEM-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.30 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|