C14H18N4O5 — CID 139562752
(2-hydroxy-5-oxopyrrolidin-1-yl) N-[3-carbamoyl-4-(dimethylamino)phenyl]carbamate (PubChem CID 139562752) has the molecular formula C14H18N4O5 and a molecular weight of 322.32 g/mol. Its IUPAC name is (2-hydroxy-5-oxopyrrolidin-1-yl) N-[3-carbamoyl-4-(dimethylamino)phenyl]carbamate.
| Compound Name | (2-hydroxy-5-oxopyrrolidin-1-yl) N-[3-carbamoyl-4-(dimethylamino)phenyl]carbamate |
|---|---|
| PubChem CID | 139562752 |
| Molecular Formula | C14H18N4O5 |
| Molecular Weight | 322.32 g/mol |
| Exact Mass | 322.13 |
| IUPAC Name | (2-hydroxy-5-oxopyrrolidin-1-yl) N-[3-carbamoyl-4-(dimethylamino)phenyl]carbamate |
| SMILES | CN(C)c1ccc(NC(=O)ON2C(=O)CCC2O)cc1C(N)=O |
| InChI | InChI=1S/C14H18N4O5/c1-17(2)10-4-3-8(7-9(10)13(15)21)16-14(22)23-18-11(19)5-6-12(18)20/h3-4,7,11,19H,5-6H2,1-2H3,(H2,15,21)(H,16,22) |
| InChIKey | ZIIPDWIXCBJFMH-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 125.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.32 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|