C13H11NO6 — CID 59294693
(4-acetylphenyl) (2,5-dioxopyrrolidin-1-yl) carbonate (PubChem CID 59294693) has the molecular formula C13H11NO6 and a molecular weight of 277.23 g/mol. Its IUPAC name is (4-acetylphenyl) (2,5-dioxopyrrolidin-1-yl) carbonate.
| Compound Name | (4-acetylphenyl) (2,5-dioxopyrrolidin-1-yl) carbonate |
|---|---|
| PubChem CID | 59294693 |
| Molecular Formula | C13H11NO6 |
| Molecular Weight | 277.23 g/mol |
| Exact Mass | 277.06 |
| IUPAC Name | (4-acetylphenyl) (2,5-dioxopyrrolidin-1-yl) carbonate |
| SMILES | CC(=O)c1ccc(OC(=O)ON2C(=O)CCC2=O)cc1 |
| InChI | InChI=1S/C13H11NO6/c1-8(15)9-2-4-10(5-3-9)19-13(18)20-14-11(16)6-7-12(14)17/h2-5H,6-7H2,1H3 |
| InChIKey | FBTRHZBHIGISGR-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.23 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|