About (4-acetylphenyl) carbamate;ethane
(4-acetylphenyl) carbamate;ethane (PubChem CID 163253714) has the molecular formula C11H15NO3
and a molecular weight of 209.24 g/mol. Its IUPAC name is (4-acetylphenyl) carbamate;ethane.
Molecular Properties
| Compound Name | (4-acetylphenyl) carbamate;ethane |
| PubChem CID | 163253714 |
| Molecular Formula | C11H15NO3 |
| Molecular Weight | 209.24 g/mol |
| Exact Mass | 209.11 |
| IUPAC Name | (4-acetylphenyl) carbamate;ethane |
| SMILES | CC.CC(=O)c1ccc(OC(N)=O)cc1 |
| InChI | InChI=1S/C9H9NO3.C2H6/c1-6(11)7-2-4-8(5-3-7)13-9(10)12;1-2/h2-5H,1H3,(H2,10,12);1-2H3 |
| InChIKey | DTNFKVNCZRZOQY-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.24 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (4-acetylphenyl) carbamate;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-acetylphenyl) carbamate;ethane?
The IUPAC name of (4-acetylphenyl) carbamate;ethane (CID 163253714) is (4-acetylphenyl) carbamate;ethane.
What is the SMILES notation for (4-acetylphenyl) carbamate;ethane?
The canonical SMILES for (4-acetylphenyl) carbamate;ethane is CC.CC(=O)c1ccc(OC(N)=O)cc1.
What is the InChIKey of (4-acetylphenyl) carbamate;ethane?
The InChIKey is DTNFKVNCZRZOQY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9NO3.C2H6/c1-6(11)7-2-4-8(5-3-7)13-9(10)12;1-2/h2-5H,1H3,(H2,10,12);1-2H3.
What are the key properties of (4-acetylphenyl) carbamate;ethane?
(4-acetylphenyl) carbamate;ethane has a molecular weight of 209.24 g/mol, XLogP of 2.37, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-acetylphenyl) carbamate;ethane is sourced from PubChem (CID 163253714), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).