C12H17NO5 — CID 153133144
(2-hydroxy-5-oxopyrrolidin-1-yl) [(5S)-1-methyl-3-bicyclo[3.1.0]hexanyl] carbonate (PubChem CID 153133144) has the molecular formula C12H17NO5 and a molecular weight of 255.27 g/mol. Its IUPAC name is (2-hydroxy-5-oxopyrrolidin-1-yl) [(5S)-1-methyl-3-bicyclo[3.1.0]hexanyl] carbonate.
| Compound Name | (2-hydroxy-5-oxopyrrolidin-1-yl) [(5S)-1-methyl-3-bicyclo[3.1.0]hexanyl] carbonate |
|---|---|
| PubChem CID | 153133144 |
| Molecular Formula | C12H17NO5 |
| Molecular Weight | 255.27 g/mol |
| Exact Mass | 255.11 |
| IUPAC Name | (2-hydroxy-5-oxopyrrolidin-1-yl) [(5S)-1-methyl-3-bicyclo[3.1.0]hexanyl] carbonate |
| SMILES | CC12CC(OC(=O)ON3C(=O)CCC3O)C[C@@H]1C2 |
| InChI | InChI=1S/C12H17NO5/c1-12-5-7(12)4-8(6-12)17-11(16)18-13-9(14)2-3-10(13)15/h7-9,14H,2-6H2,1H3/t7-,8?,9?,12?/m1/s1 |
| InChIKey | VXDCASZZOCAPPK-SNYNKORZSA-N |
| XLogP | 1.18 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.27 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |