C30H43NO14 — CID 89137179
(2,5-dioxopyrrolidin-1-yl) 3-[3-(3-prop-2-enoyloxypropoxy)-2,2-bis(3-prop-2-enoyloxypropoxymethyl)propoxy]propanoate (PubChem CID 89137179) has the molecular formula C30H43NO14 and a molecular weight of 641.67 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 3-[3-(3-prop-2-enoyloxypropoxy)-2,2-bis(3-prop-2-enoyloxypropoxymethyl)propoxy]propanoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 3-[3-(3-prop-2-enoyloxypropoxy)-2,2-bis(3-prop-2-enoyloxypropoxymethyl)propoxy]propanoate |
|---|---|
| PubChem CID | 89137179 |
| Molecular Formula | C30H43NO14 |
| Molecular Weight | 641.67 g/mol |
| Exact Mass | 641.27 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 3-[3-(3-prop-2-enoyloxypropoxy)-2,2-bis(3-prop-2-enoyloxypropoxymethyl)propoxy]propanoate |
| SMILES | C=CC(=O)OCCCOCC(COCCCOC(=O)C=C)(COCCCOC(=O)C=C)COCCC(=O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C30H43NO14/c1-4-26(34)42-16-7-13-38-20-30(21-39-14-8-17-43-27(35)5-2,22-40-15-9-18-44-28(36)6-3)23-41-19-12-29(37)45-31-24(32)10-11-25(31)33/h4-6H,1-3,7-23H2 |
| InChIKey | FOPSIUBZRNEYSH-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 179.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.67 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|