About (4-iodophenyl)methyl 5-amino-2-methylbenzoate
(4-iodophenyl)methyl 5-amino-2-methylbenzoate (PubChem CID 65477126) has the molecular formula C15H14INO2
and a molecular weight of 367.19 g/mol. Its IUPAC name is (4-iodophenyl)methyl 5-amino-2-methylbenzoate.
Molecular Properties
| Compound Name | (4-iodophenyl)methyl 5-amino-2-methylbenzoate |
| PubChem CID | 65477126 |
| Molecular Formula | C15H14INO2 |
| Molecular Weight | 367.19 g/mol |
| Exact Mass | 367.01 |
| IUPAC Name | (4-iodophenyl)methyl 5-amino-2-methylbenzoate |
| SMILES | Cc1ccc(N)cc1C(=O)OCc1ccc(I)cc1 |
| InChI | InChI=1S/C15H14INO2/c1-10-2-7-13(17)8-14(10)15(18)19-9-11-3-5-12(16)6-4-11/h2-8H,9,17H2,1H3 |
| InChIKey | CDZTZFOBIQGMDO-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 367.19 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze (4-iodophenyl)methyl 5-amino-2-methylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-iodophenyl)methyl 5-amino-2-methylbenzoate?
The IUPAC name of (4-iodophenyl)methyl 5-amino-2-methylbenzoate (CID 65477126) is (4-iodophenyl)methyl 5-amino-2-methylbenzoate.
What is the SMILES notation for (4-iodophenyl)methyl 5-amino-2-methylbenzoate?
The canonical SMILES for (4-iodophenyl)methyl 5-amino-2-methylbenzoate is Cc1ccc(N)cc1C(=O)OCc1ccc(I)cc1.
What is the InChIKey of (4-iodophenyl)methyl 5-amino-2-methylbenzoate?
The InChIKey is CDZTZFOBIQGMDO-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14INO2/c1-10-2-7-13(17)8-14(10)15(18)19-9-11-3-5-12(16)6-4-11/h2-8H,9,17H2,1H3.
What are the key properties of (4-iodophenyl)methyl 5-amino-2-methylbenzoate?
(4-iodophenyl)methyl 5-amino-2-methylbenzoate has a molecular weight of 367.19 g/mol, XLogP of 3.54, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-iodophenyl)methyl 5-amino-2-methylbenzoate is sourced from PubChem (CID 65477126), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).