About (4-aminophenyl)methyl 5-amino-2-[(E)-prop-1-enyl]benzoate
(4-aminophenyl)methyl 5-amino-2-[(E)-prop-1-enyl]benzoate (PubChem CID 173155737) has the molecular formula C17H18N2O2
and a molecular weight of 282.34 g/mol. Its IUPAC name is (4-aminophenyl)methyl 5-amino-2-[(E)-prop-1-enyl]benzoate.
Molecular Properties
| Compound Name | (4-aminophenyl)methyl 5-amino-2-[(E)-prop-1-enyl]benzoate |
| PubChem CID | 173155737 |
| Molecular Formula | C17H18N2O2 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.14 |
| IUPAC Name | (4-aminophenyl)methyl 5-amino-2-[(E)-prop-1-enyl]benzoate |
| SMILES | C/C=C/c1ccc(N)cc1C(=O)OCc1ccc(N)cc1 |
| InChI | InChI=1S/C17H18N2O2/c1-2-3-13-6-9-15(19)10-16(13)17(20)21-11-12-4-7-14(18)8-5-12/h2-10H,11,18-19H2,1H3/b3-2+ |
| InChIKey | JXOIIGSCWLMUIL-NSCUHMNNSA-N |
| XLogP | 3.24 |
| TPSA | 78.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze (4-aminophenyl)methyl 5-amino-2-[(E)-prop-1-enyl]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-aminophenyl)methyl 5-amino-2-[(E)-prop-1-enyl]benzoate?
The IUPAC name of (4-aminophenyl)methyl 5-amino-2-[(E)-prop-1-enyl]benzoate (CID 173155737) is (4-aminophenyl)methyl 5-amino-2-[(E)-prop-1-enyl]benzoate.
What is the SMILES notation for (4-aminophenyl)methyl 5-amino-2-[(E)-prop-1-enyl]benzoate?
The canonical SMILES for (4-aminophenyl)methyl 5-amino-2-[(E)-prop-1-enyl]benzoate is C/C=C/c1ccc(N)cc1C(=O)OCc1ccc(N)cc1.
What is the InChIKey of (4-aminophenyl)methyl 5-amino-2-[(E)-prop-1-enyl]benzoate?
The InChIKey is JXOIIGSCWLMUIL-NSCUHMNNSA-N. The full InChI is InChI=1S/C17H18N2O2/c1-2-3-13-6-9-15(19)10-16(13)17(20)21-11-12-4-7-14(18)8-5-12/h2-10H,11,18-19H2,1H3/b3-2+.
What are the key properties of (4-aminophenyl)methyl 5-amino-2-[(E)-prop-1-enyl]benzoate?
(4-aminophenyl)methyl 5-amino-2-[(E)-prop-1-enyl]benzoate has a molecular weight of 282.34 g/mol, XLogP of 3.24, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-aminophenyl)methyl 5-amino-2-[(E)-prop-1-enyl]benzoate is sourced from PubChem (CID 173155737), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).