C15H14ClNO2S — CID 55535082
(6-chloro-3-pyridinyl)methyl 4,5,6,7-tetrahydro-1-benzothiophene-2-carboxylate (PubChem CID 55535082) has the molecular formula C15H14ClNO2S and a molecular weight of 307.80 g/mol. Its IUPAC name is (6-chloro-3-pyridinyl)methyl 4,5,6,7-tetrahydro-1-benzothiophene-2-carboxylate.
| Compound Name | (6-chloro-3-pyridinyl)methyl 4,5,6,7-tetrahydro-1-benzothiophene-2-carboxylate |
|---|---|
| PubChem CID | 55535082 |
| Molecular Formula | C15H14ClNO2S |
| Molecular Weight | 307.80 g/mol |
| Exact Mass | 307.04 |
| IUPAC Name | (6-chloro-3-pyridinyl)methyl 4,5,6,7-tetrahydro-1-benzothiophene-2-carboxylate |
| SMILES | O=C(OCc1ccc(Cl)nc1)c1cc2c(s1)CCCC2 |
| InChI | InChI=1S/C15H14ClNO2S/c16-14-6-5-10(8-17-14)9-19-15(18)13-7-11-3-1-2-4-12(11)20-13/h5-8H,1-4,9H2 |
| InChIKey | FMGLTZSOWUNKQW-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.80 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|