C21H22ClNO5S — CID 3934569
(1-oxo-1-phenylpropan-2-yl) 4-chloro-3-piperidin-1-ylsulfonylbenzoate (PubChem CID 3934569) has the molecular formula C21H22ClNO5S and a molecular weight of 435.93 g/mol. Its IUPAC name is (1-oxo-1-phenylpropan-2-yl) 4-chloro-3-piperidin-1-ylsulfonylbenzoate.
| Compound Name | (1-oxo-1-phenylpropan-2-yl) 4-chloro-3-piperidin-1-ylsulfonylbenzoate |
|---|---|
| PubChem CID | 3934569 |
| Molecular Formula | C21H22ClNO5S |
| Molecular Weight | 435.93 g/mol |
| Exact Mass | 435.09 |
| IUPAC Name | (1-oxo-1-phenylpropan-2-yl) 4-chloro-3-piperidin-1-ylsulfonylbenzoate |
| SMILES | CC(OC(=O)c1ccc(Cl)c(S(=O)(=O)N2CCCCC2)c1)C(=O)c1ccccc1 |
| InChI | InChI=1S/C21H22ClNO5S/c1-15(20(24)16-8-4-2-5-9-16)28-21(25)17-10-11-18(22)19(14-17)29(26,27)23-12-6-3-7-13-23/h2,4-5,8-11,14-15H,3,6-7,12-13H2,1H3 |
| InChIKey | HDUKJLOKPPCWTD-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.93 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |