C20H20FNO6S — CID 16578086
(1-oxo-1-phenylpropan-2-yl) 4-fluoro-3-morpholin-4-ylsulfonylbenzoate (PubChem CID 16578086) has the molecular formula C20H20FNO6S and a molecular weight of 421.45 g/mol. Its IUPAC name is (1-oxo-1-phenylpropan-2-yl) 4-fluoro-3-morpholin-4-ylsulfonylbenzoate.
| Compound Name | (1-oxo-1-phenylpropan-2-yl) 4-fluoro-3-morpholin-4-ylsulfonylbenzoate |
|---|---|
| PubChem CID | 16578086 |
| Molecular Formula | C20H20FNO6S |
| Molecular Weight | 421.45 g/mol |
| Exact Mass | 421.10 |
| IUPAC Name | (1-oxo-1-phenylpropan-2-yl) 4-fluoro-3-morpholin-4-ylsulfonylbenzoate |
| SMILES | CC(OC(=O)c1ccc(F)c(S(=O)(=O)N2CCOCC2)c1)C(=O)c1ccccc1 |
| InChI | InChI=1S/C20H20FNO6S/c1-14(19(23)15-5-3-2-4-6-15)28-20(24)16-7-8-17(21)18(13-16)29(25,26)22-9-11-27-12-10-22/h2-8,13-14H,9-12H2,1H3 |
| InChIKey | SJUHINVCZNAUGA-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.45 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |