C20H19Cl2NO5S — CID 16560169
[1-(4-chlorophenyl)-1-oxopropan-2-yl] 4-chloro-3-pyrrolidin-1-ylsulfonylbenzoate (PubChem CID 16560169) has the molecular formula C20H19Cl2NO5S and a molecular weight of 456.35 g/mol. Its IUPAC name is [1-(4-chlorophenyl)-1-oxopropan-2-yl] 4-chloro-3-pyrrolidin-1-ylsulfonylbenzoate.
| Compound Name | [1-(4-chlorophenyl)-1-oxopropan-2-yl] 4-chloro-3-pyrrolidin-1-ylsulfonylbenzoate |
|---|---|
| PubChem CID | 16560169 |
| Molecular Formula | C20H19Cl2NO5S |
| Molecular Weight | 456.35 g/mol |
| Exact Mass | 455.04 |
| IUPAC Name | [1-(4-chlorophenyl)-1-oxopropan-2-yl] 4-chloro-3-pyrrolidin-1-ylsulfonylbenzoate |
| SMILES | CC(OC(=O)c1ccc(Cl)c(S(=O)(=O)N2CCCC2)c1)C(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H19Cl2NO5S/c1-13(19(24)14-4-7-16(21)8-5-14)28-20(25)15-6-9-17(22)18(12-15)29(26,27)23-10-2-3-11-23/h4-9,12-13H,2-3,10-11H2,1H3 |
| InChIKey | XMYJWHLDLVLVGD-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.35 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |