C17H23FN2O5S — CID 18091871
[1-(azepan-1-yl)-1-oxopropan-2-yl] 2-fluoro-5-(methylsulfamoyl)benzoate (PubChem CID 18091871) has the molecular formula C17H23FN2O5S and a molecular weight of 386.45 g/mol. Its IUPAC name is [1-(azepan-1-yl)-1-oxopropan-2-yl] 2-fluoro-5-(methylsulfamoyl)benzoate.
| Compound Name | [1-(azepan-1-yl)-1-oxopropan-2-yl] 2-fluoro-5-(methylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 18091871 |
| Molecular Formula | C17H23FN2O5S |
| Molecular Weight | 386.45 g/mol |
| Exact Mass | 386.13 |
| IUPAC Name | [1-(azepan-1-yl)-1-oxopropan-2-yl] 2-fluoro-5-(methylsulfamoyl)benzoate |
| SMILES | CNS(=O)(=O)c1ccc(F)c(C(=O)OC(C)C(=O)N2CCCCCC2)c1 |
| InChI | InChI=1S/C17H23FN2O5S/c1-12(16(21)20-9-5-3-4-6-10-20)25-17(22)14-11-13(7-8-15(14)18)26(23,24)19-2/h7-8,11-12,19H,3-6,9-10H2,1-2H3 |
| InChIKey | LSARZSQTTHAYHK-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.45 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |