C16H21FN2O5S — CID 8943038
[(2S)-1-(azepan-1-yl)-1-oxopropan-2-yl] 2-fluoro-5-sulfamoylbenzoate (PubChem CID 8943038) has the molecular formula C16H21FN2O5S and a molecular weight of 372.42 g/mol. Its IUPAC name is [(2S)-1-(azepan-1-yl)-1-oxopropan-2-yl] 2-fluoro-5-sulfamoylbenzoate.
| Compound Name | [(2S)-1-(azepan-1-yl)-1-oxopropan-2-yl] 2-fluoro-5-sulfamoylbenzoate |
|---|---|
| PubChem CID | 8943038 |
| Molecular Formula | C16H21FN2O5S |
| Molecular Weight | 372.42 g/mol |
| Exact Mass | 372.12 |
| IUPAC Name | [(2S)-1-(azepan-1-yl)-1-oxopropan-2-yl] 2-fluoro-5-sulfamoylbenzoate |
| SMILES | C[C@H](OC(=O)c1cc(S(N)(=O)=O)ccc1F)C(=O)N1CCCCCC1 |
| InChI | InChI=1S/C16H21FN2O5S/c1-11(15(20)19-8-4-2-3-5-9-19)24-16(21)13-10-12(25(18,22)23)6-7-14(13)17/h6-7,10-11H,2-5,8-9H2,1H3,(H2,18,22,23)/t11-/m0/s1 |
| InChIKey | LCBTYCKZHCMXLB-NSHDSACASA-N |
| XLogP | 1.42 |
| TPSA | 106.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.42 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |