C22H22ClN3O6S — CID 51922745
[2-[N-(cyanomethyl)anilino]-2-oxoethyl] 4-chloro-3-[[(2S)-oxolan-2-yl]methylsulfamoyl]benzoate (PubChem CID 51922745) has the molecular formula C22H22ClN3O6S and a molecular weight of 491.95 g/mol. Its IUPAC name is [2-[N-(cyanomethyl)anilino]-2-oxoethyl] 4-chloro-3-[[(2S)-oxolan-2-yl]methylsulfamoyl]benzoate.
| Compound Name | [2-[N-(cyanomethyl)anilino]-2-oxoethyl] 4-chloro-3-[[(2S)-oxolan-2-yl]methylsulfamoyl]benzoate |
|---|---|
| PubChem CID | 51922745 |
| Molecular Formula | C22H22ClN3O6S |
| Molecular Weight | 491.95 g/mol |
| Exact Mass | 491.09 |
| IUPAC Name | [2-[N-(cyanomethyl)anilino]-2-oxoethyl] 4-chloro-3-[[(2S)-oxolan-2-yl]methylsulfamoyl]benzoate |
| SMILES | N#CCN(C(=O)COC(=O)c1ccc(Cl)c(S(=O)(=O)NC[C@@H]2CCCO2)c1)c1ccccc1 |
| InChI | InChI=1S/C22H22ClN3O6S/c23-19-9-8-16(13-20(19)33(29,30)25-14-18-7-4-12-31-18)22(28)32-15-21(27)26(11-10-24)17-5-2-1-3-6-17/h1-3,5-6,8-9,13,18,25H,4,7,11-12,14-15H2/t18-/m0/s1 |
| InChIKey | ZZTWOYMWXMLKMA-SFHVURJKSA-N |
| XLogP | 2.51 |
| TPSA | 125.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.95 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|