C22H26Cl2N2O5S — CID 42582851
N-(4-butoxyphenyl)-2,4-dichloro-5-[[(2S)-oxolan-2-yl]methylsulfamoyl]benzamide (PubChem CID 42582851) has the molecular formula C22H26Cl2N2O5S and a molecular weight of 501.43 g/mol. Its IUPAC name is N-(4-butoxyphenyl)-2,4-dichloro-5-[[(2S)-oxolan-2-yl]methylsulfamoyl]benzamide.
| Compound Name | N-(4-butoxyphenyl)-2,4-dichloro-5-[[(2S)-oxolan-2-yl]methylsulfamoyl]benzamide |
|---|---|
| PubChem CID | 42582851 |
| Molecular Formula | C22H26Cl2N2O5S |
| Molecular Weight | 501.43 g/mol |
| Exact Mass | 500.09 |
| IUPAC Name | N-(4-butoxyphenyl)-2,4-dichloro-5-[[(2S)-oxolan-2-yl]methylsulfamoyl]benzamide |
| SMILES | CCCCOc1ccc(NC(=O)c2cc(S(=O)(=O)NC[C@@H]3CCCO3)c(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C22H26Cl2N2O5S/c1-2-3-10-30-16-8-6-15(7-9-16)26-22(27)18-12-21(20(24)13-19(18)23)32(28,29)25-14-17-5-4-11-31-17/h6-9,12-13,17,25H,2-5,10-11,14H2,1H3,(H,26,27)/t17-/m0/s1 |
| InChIKey | VLXBVYDWCFNRQT-KRWDZBQOSA-N |
| XLogP | 4.88 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.43 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|