C24H20N2O3S — CID 7214705
1,3-benzothiazol-2-ylmethyl (3S)-3-benzamido-3-phenylpropanoate (PubChem CID 7214705) has the molecular formula C24H20N2O3S and a molecular weight of 416.50 g/mol. Its IUPAC name is 1,3-benzothiazol-2-ylmethyl (3S)-3-benzamido-3-phenylpropanoate.
| Compound Name | 1,3-benzothiazol-2-ylmethyl (3S)-3-benzamido-3-phenylpropanoate |
|---|---|
| PubChem CID | 7214705 |
| Molecular Formula | C24H20N2O3S |
| Molecular Weight | 416.50 g/mol |
| Exact Mass | 416.12 |
| IUPAC Name | 1,3-benzothiazol-2-ylmethyl (3S)-3-benzamido-3-phenylpropanoate |
| SMILES | O=C(C[C@H](NC(=O)c1ccccc1)c1ccccc1)OCc1nc2ccccc2s1 |
| InChI | InChI=1S/C24H20N2O3S/c27-23(29-16-22-25-19-13-7-8-14-21(19)30-22)15-20(17-9-3-1-4-10-17)26-24(28)18-11-5-2-6-12-18/h1-14,20H,15-16H2,(H,26,28)/t20-/m0/s1 |
| InChIKey | WJLCICJRYGDZOG-FQEVSTJZSA-N |
| XLogP | 4.90 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.50 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |