C24H21N3O3 — CID 7151779
imidazo[1,2-a]pyridin-2-ylmethyl (3R)-3-benzamido-3-phenylpropanoate (PubChem CID 7151779) has the molecular formula C24H21N3O3 and a molecular weight of 399.45 g/mol. Its IUPAC name is imidazo[1,2-a]pyridin-2-ylmethyl (3R)-3-benzamido-3-phenylpropanoate.
| Compound Name | imidazo[1,2-a]pyridin-2-ylmethyl (3R)-3-benzamido-3-phenylpropanoate |
|---|---|
| PubChem CID | 7151779 |
| Molecular Formula | C24H21N3O3 |
| Molecular Weight | 399.45 g/mol |
| Exact Mass | 399.16 |
| IUPAC Name | imidazo[1,2-a]pyridin-2-ylmethyl (3R)-3-benzamido-3-phenylpropanoate |
| SMILES | O=C(C[C@@H](NC(=O)c1ccccc1)c1ccccc1)OCc1cn2ccccc2n1 |
| InChI | InChI=1S/C24H21N3O3/c28-23(30-17-20-16-27-14-8-7-13-22(27)25-20)15-21(18-9-3-1-4-10-18)26-24(29)19-11-5-2-6-12-19/h1-14,16,21H,15,17H2,(H,26,29)/t21-/m1/s1 |
| InChIKey | BLGXPRFTHCKTAK-OAQYLSRUSA-N |
| XLogP | 3.94 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.45 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |