C27H23NO3 — CID 7221887
naphthalen-1-ylmethyl (3S)-3-benzamido-3-phenylpropanoate (PubChem CID 7221887) has the molecular formula C27H23NO3 and a molecular weight of 409.49 g/mol. Its IUPAC name is naphthalen-1-ylmethyl (3S)-3-benzamido-3-phenylpropanoate.
| Compound Name | naphthalen-1-ylmethyl (3S)-3-benzamido-3-phenylpropanoate |
|---|---|
| PubChem CID | 7221887 |
| Molecular Formula | C27H23NO3 |
| Molecular Weight | 409.49 g/mol |
| Exact Mass | 409.17 |
| IUPAC Name | naphthalen-1-ylmethyl (3S)-3-benzamido-3-phenylpropanoate |
| SMILES | O=C(C[C@H](NC(=O)c1ccccc1)c1ccccc1)OCc1cccc2ccccc12 |
| InChI | InChI=1S/C27H23NO3/c29-26(31-19-23-16-9-15-20-10-7-8-17-24(20)23)18-25(21-11-3-1-4-12-21)28-27(30)22-13-5-2-6-14-22/h1-17,25H,18-19H2,(H,28,30)/t25-/m0/s1 |
| InChIKey | GBCPJIISMYXPLK-VWLOTQADSA-N |
| XLogP | 5.44 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.49 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |