C22H18ClNO4S — CID 16503859
[2-(5-chlorothiophen-2-yl)-2-oxoethyl] 3-benzamido-3-phenylpropanoate (PubChem CID 16503859) has the molecular formula C22H18ClNO4S and a molecular weight of 427.91 g/mol. Its IUPAC name is [2-(5-chlorothiophen-2-yl)-2-oxoethyl] 3-benzamido-3-phenylpropanoate.
| Compound Name | [2-(5-chlorothiophen-2-yl)-2-oxoethyl] 3-benzamido-3-phenylpropanoate |
|---|---|
| PubChem CID | 16503859 |
| Molecular Formula | C22H18ClNO4S |
| Molecular Weight | 427.91 g/mol |
| Exact Mass | 427.06 |
| IUPAC Name | [2-(5-chlorothiophen-2-yl)-2-oxoethyl] 3-benzamido-3-phenylpropanoate |
| SMILES | O=C(CC(NC(=O)c1ccccc1)c1ccccc1)OCC(=O)c1ccc(Cl)s1 |
| InChI | InChI=1S/C22H18ClNO4S/c23-20-12-11-19(29-20)18(25)14-28-21(26)13-17(15-7-3-1-4-8-15)24-22(27)16-9-5-2-6-10-16/h1-12,17H,13-14H2,(H,24,27) |
| InChIKey | LLUSQYJIVXHODU-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.91 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |