C15H9BrN2O5S — CID 26780410
(5-thiophen-2-yl-1,2-oxazol-3-yl)methyl 4-bromo-3-nitrobenzoate (PubChem CID 26780410) has the molecular formula C15H9BrN2O5S and a molecular weight of 409.22 g/mol. Its IUPAC name is (5-thiophen-2-yl-1,2-oxazol-3-yl)methyl 4-bromo-3-nitrobenzoate.
| Compound Name | (5-thiophen-2-yl-1,2-oxazol-3-yl)methyl 4-bromo-3-nitrobenzoate |
|---|---|
| PubChem CID | 26780410 |
| Molecular Formula | C15H9BrN2O5S |
| Molecular Weight | 409.22 g/mol |
| Exact Mass | 407.94 |
| IUPAC Name | (5-thiophen-2-yl-1,2-oxazol-3-yl)methyl 4-bromo-3-nitrobenzoate |
| SMILES | O=C(OCc1cc(-c2cccs2)on1)c1ccc(Br)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C15H9BrN2O5S/c16-11-4-3-9(6-12(11)18(20)21)15(19)22-8-10-7-13(23-17-10)14-2-1-5-24-14/h1-7H,8H2 |
| InChIKey | DXJUJAWGNKPEAC-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 95.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.22 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|