C27H16N2O5S — CID 16577503
(5-thiophen-2-yl-1,2-oxazol-3-yl)methyl 4-(1,3-dioxobenzo[de]isoquinolin-2-yl)benzoate (PubChem CID 16577503) has the molecular formula C27H16N2O5S and a molecular weight of 480.50 g/mol. Its IUPAC name is (5-thiophen-2-yl-1,2-oxazol-3-yl)methyl 4-(1,3-dioxobenzo[de]isoquinolin-2-yl)benzoate.
| Compound Name | (5-thiophen-2-yl-1,2-oxazol-3-yl)methyl 4-(1,3-dioxobenzo[de]isoquinolin-2-yl)benzoate |
|---|---|
| PubChem CID | 16577503 |
| Molecular Formula | C27H16N2O5S |
| Molecular Weight | 480.50 g/mol |
| Exact Mass | 480.08 |
| IUPAC Name | (5-thiophen-2-yl-1,2-oxazol-3-yl)methyl 4-(1,3-dioxobenzo[de]isoquinolin-2-yl)benzoate |
| SMILES | O=C(OCc1cc(-c2cccs2)on1)c1ccc(N2C(=O)c3cccc4cccc(c34)C2=O)cc1 |
| InChI | InChI=1S/C27H16N2O5S/c30-25-20-6-1-4-16-5-2-7-21(24(16)20)26(31)29(25)19-11-9-17(10-12-19)27(32)33-15-18-14-22(34-28-18)23-8-3-13-35-23/h1-14H,15H2 |
| InChIKey | BBASGUVYEBPZHD-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 89.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.50 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|