C15H16N2O5 — CID 17418197
(5-methyl-1,2-oxazol-3-yl)methyl 3-(ethoxycarbonylamino)benzoate (PubChem CID 17418197) has the molecular formula C15H16N2O5 and a molecular weight of 304.30 g/mol. Its IUPAC name is (5-methyl-1,2-oxazol-3-yl)methyl 3-(ethoxycarbonylamino)benzoate.
| Compound Name | (5-methyl-1,2-oxazol-3-yl)methyl 3-(ethoxycarbonylamino)benzoate |
|---|---|
| PubChem CID | 17418197 |
| Molecular Formula | C15H16N2O5 |
| Molecular Weight | 304.30 g/mol |
| Exact Mass | 304.11 |
| IUPAC Name | (5-methyl-1,2-oxazol-3-yl)methyl 3-(ethoxycarbonylamino)benzoate |
| SMILES | CCOC(=O)Nc1cccc(C(=O)OCc2cc(C)on2)c1 |
| InChI | InChI=1S/C15H16N2O5/c1-3-20-15(19)16-12-6-4-5-11(8-12)14(18)21-9-13-7-10(2)22-17-13/h4-8H,3,9H2,1-2H3,(H,16,19) |
| InChIKey | PWPYJXVPACXOJV-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 90.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.30 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |