C17H29N3O4 — CID 131990896
2,8,17-trioxa-5,11,14-triazabicyclo[16.4.0]docosa-1(18),19,21-trien-21-ylmethanol (PubChem CID 131990896) has the molecular formula C17H29N3O4 and a molecular weight of 339.44 g/mol. Its IUPAC name is 2,8,17-trioxa-5,11,14-triazabicyclo[16.4.0]docosa-1(18),19,21-trien-21-ylmethanol.
| Compound Name | 2,8,17-trioxa-5,11,14-triazabicyclo[16.4.0]docosa-1(18),19,21-trien-21-ylmethanol |
|---|---|
| PubChem CID | 131990896 |
| Molecular Formula | C17H29N3O4 |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.22 |
| IUPAC Name | 2,8,17-trioxa-5,11,14-triazabicyclo[16.4.0]docosa-1(18),19,21-trien-21-ylmethanol |
| SMILES | OCc1ccc2c(c1)OCCNCCOCCNCCNCCO2 |
| InChI | InChI=1S/C17H29N3O4/c21-14-15-1-2-16-17(13-15)24-12-8-20-6-10-22-9-5-18-3-4-19-7-11-23-16/h1-2,13,18-21H,3-12,14H2 |
| InChIKey | CZPUGCLMJPEBCL-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 84.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |