C30H38N4O6S — CID 22498306
tert-butyl 2-(dimethylcarbamoyl)-4-[2-[3-nitro-4-(2-propan-2-ylphenyl)sulfanylphenyl]prop-2-enoyl]piperazine-1-carboxylate (PubChem CID 22498306) has the molecular formula C30H38N4O6S and a molecular weight of 582.72 g/mol. Its IUPAC name is tert-butyl 2-(dimethylcarbamoyl)-4-[2-[3-nitro-4-(2-propan-2-ylphenyl)sulfanylphenyl]prop-2-enoyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 2-(dimethylcarbamoyl)-4-[2-[3-nitro-4-(2-propan-2-ylphenyl)sulfanylphenyl]prop-2-enoyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 22498306 |
| Molecular Formula | C30H38N4O6S |
| Molecular Weight | 582.72 g/mol |
| Exact Mass | 582.25 |
| IUPAC Name | tert-butyl 2-(dimethylcarbamoyl)-4-[2-[3-nitro-4-(2-propan-2-ylphenyl)sulfanylphenyl]prop-2-enoyl]piperazine-1-carboxylate |
| SMILES | C=C(C(=O)N1CCN(C(=O)OC(C)(C)C)C(C(=O)N(C)C)C1)c1ccc(Sc2ccccc2C(C)C)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C30H38N4O6S/c1-19(2)22-11-9-10-12-25(22)41-26-14-13-21(17-23(26)34(38)39)20(3)27(35)32-15-16-33(29(37)40-30(4,5)6)24(18-32)28(36)31(7)8/h9-14,17,19,24H,3,15-16,18H2,1-2,4-8H3 |
| InChIKey | UAXVJOWDZGHFFO-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 113.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.72 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|