C29H31N5O4S — CID 22498482
4-[2-[3-nitro-4-(2-propan-2-ylphenyl)sulfanylphenyl]prop-2-enoyl]-N-(pyridin-2-ylmethyl)piperazine-2-carboxamide (PubChem CID 22498482) has the molecular formula C29H31N5O4S and a molecular weight of 545.67 g/mol. Its IUPAC name is 4-[2-[3-nitro-4-(2-propan-2-ylphenyl)sulfanylphenyl]prop-2-enoyl]-N-(pyridin-2-ylmethyl)piperazine-2-carboxamide.
| Compound Name | 4-[2-[3-nitro-4-(2-propan-2-ylphenyl)sulfanylphenyl]prop-2-enoyl]-N-(pyridin-2-ylmethyl)piperazine-2-carboxamide |
|---|---|
| PubChem CID | 22498482 |
| Molecular Formula | C29H31N5O4S |
| Molecular Weight | 545.67 g/mol |
| Exact Mass | 545.21 |
| IUPAC Name | 4-[2-[3-nitro-4-(2-propan-2-ylphenyl)sulfanylphenyl]prop-2-enoyl]-N-(pyridin-2-ylmethyl)piperazine-2-carboxamide |
| SMILES | C=C(C(=O)N1CCNC(C(=O)NCc2ccccn2)C1)c1ccc(Sc2ccccc2C(C)C)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C29H31N5O4S/c1-19(2)23-9-4-5-10-26(23)39-27-12-11-21(16-25(27)34(37)38)20(3)29(36)33-15-14-31-24(18-33)28(35)32-17-22-8-6-7-13-30-22/h4-13,16,19,24,31H,3,14-15,17-18H2,1-2H3,(H,32,35) |
| InChIKey | ORAPDPZUZGUWMO-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 117.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.67 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|