C19H21N3O3S — CID 3435949
(4-methylpiperidin-1-yl)-[3-nitro-4-(pyridin-2-ylmethylsulfanyl)phenyl]methanone (PubChem CID 3435949) has the molecular formula C19H21N3O3S and a molecular weight of 371.46 g/mol. Its IUPAC name is (4-methylpiperidin-1-yl)-[3-nitro-4-(pyridin-2-ylmethylsulfanyl)phenyl]methanone.
| Compound Name | (4-methylpiperidin-1-yl)-[3-nitro-4-(pyridin-2-ylmethylsulfanyl)phenyl]methanone |
|---|---|
| PubChem CID | 3435949 |
| Molecular Formula | C19H21N3O3S |
| Molecular Weight | 371.46 g/mol |
| Exact Mass | 371.13 |
| IUPAC Name | (4-methylpiperidin-1-yl)-[3-nitro-4-(pyridin-2-ylmethylsulfanyl)phenyl]methanone |
| SMILES | CC1CCN(C(=O)c2ccc(SCc3ccccn3)c([N+](=O)[O-])c2)CC1 |
| InChI | InChI=1S/C19H21N3O3S/c1-14-7-10-21(11-8-14)19(23)15-5-6-18(17(12-15)22(24)25)26-13-16-4-2-3-9-20-16/h2-6,9,12,14H,7-8,10-11,13H2,1H3 |
| InChIKey | LVVDVHOYJVIBFD-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 76.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.46 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|