C16H22N4O4S — CID 17352788
4-(4-ethylsulfanyl-3-nitrobenzoyl)-N,N-dimethylpiperazine-1-carboxamide (PubChem CID 17352788) has the molecular formula C16H22N4O4S and a molecular weight of 366.44 g/mol. Its IUPAC name is 4-(4-ethylsulfanyl-3-nitrobenzoyl)-N,N-dimethylpiperazine-1-carboxamide.
| Compound Name | 4-(4-ethylsulfanyl-3-nitrobenzoyl)-N,N-dimethylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 17352788 |
| Molecular Formula | C16H22N4O4S |
| Molecular Weight | 366.44 g/mol |
| Exact Mass | 366.14 |
| IUPAC Name | 4-(4-ethylsulfanyl-3-nitrobenzoyl)-N,N-dimethylpiperazine-1-carboxamide |
| SMILES | CCSc1ccc(C(=O)N2CCN(C(=O)N(C)C)CC2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H22N4O4S/c1-4-25-14-6-5-12(11-13(14)20(23)24)15(21)18-7-9-19(10-8-18)16(22)17(2)3/h5-6,11H,4,7-10H2,1-3H3 |
| InChIKey | LLWCWNMEFYIEQJ-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 87.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.44 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|