C21H25N5O5 — CID 56521404
1-[4-[4-(2-methoxyethylamino)-3-nitrobenzoyl]piperazin-1-yl]-2-pyridin-2-ylethanone (PubChem CID 56521404) has the molecular formula C21H25N5O5 and a molecular weight of 427.46 g/mol. Its IUPAC name is 1-[4-[4-(2-methoxyethylamino)-3-nitrobenzoyl]piperazin-1-yl]-2-pyridin-2-ylethanone.
| Compound Name | 1-[4-[4-(2-methoxyethylamino)-3-nitrobenzoyl]piperazin-1-yl]-2-pyridin-2-ylethanone |
|---|---|
| PubChem CID | 56521404 |
| Molecular Formula | C21H25N5O5 |
| Molecular Weight | 427.46 g/mol |
| Exact Mass | 427.19 |
| IUPAC Name | 1-[4-[4-(2-methoxyethylamino)-3-nitrobenzoyl]piperazin-1-yl]-2-pyridin-2-ylethanone |
| SMILES | COCCNc1ccc(C(=O)N2CCN(C(=O)Cc3ccccn3)CC2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C21H25N5O5/c1-31-13-8-23-18-6-5-16(14-19(18)26(29)30)21(28)25-11-9-24(10-12-25)20(27)15-17-4-2-3-7-22-17/h2-7,14,23H,8-13,15H2,1H3 |
| InChIKey | CQRNBTPXJICJJM-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 117.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.46 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|