C21H24N6O6S — CID 55975513
[4-(2-methoxyethylamino)-3-nitrophenyl]-[4-(1H-pyrrolo[2,3-b]pyridin-3-ylsulfonyl)piperazin-1-yl]methanone (PubChem CID 55975513) has the molecular formula C21H24N6O6S and a molecular weight of 488.53 g/mol. Its IUPAC name is [4-(2-methoxyethylamino)-3-nitrophenyl]-[4-(1H-pyrrolo[2,3-b]pyridin-3-ylsulfonyl)piperazin-1-yl]methanone.
| Compound Name | [4-(2-methoxyethylamino)-3-nitrophenyl]-[4-(1H-pyrrolo[2,3-b]pyridin-3-ylsulfonyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 55975513 |
| Molecular Formula | C21H24N6O6S |
| Molecular Weight | 488.53 g/mol |
| Exact Mass | 488.15 |
| IUPAC Name | [4-(2-methoxyethylamino)-3-nitrophenyl]-[4-(1H-pyrrolo[2,3-b]pyridin-3-ylsulfonyl)piperazin-1-yl]methanone |
| SMILES | COCCNc1ccc(C(=O)N2CCN(S(=O)(=O)c3c[nH]c4ncccc34)CC2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C21H24N6O6S/c1-33-12-7-22-17-5-4-15(13-18(17)27(29)30)21(28)25-8-10-26(11-9-25)34(31,32)19-14-24-20-16(19)3-2-6-23-20/h2-6,13-14,22H,7-12H2,1H3,(H,23,24) |
| InChIKey | QBCPYYGRBARLMO-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 150.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.53 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|