C22H25FN4O5 — CID 55879029
[4-(3-fluoro-4-methylbenzoyl)piperazin-1-yl]-[4-(2-methoxyethylamino)-3-nitrophenyl]methanone (PubChem CID 55879029) has the molecular formula C22H25FN4O5 and a molecular weight of 444.46 g/mol. Its IUPAC name is [4-(3-fluoro-4-methylbenzoyl)piperazin-1-yl]-[4-(2-methoxyethylamino)-3-nitrophenyl]methanone.
| Compound Name | [4-(3-fluoro-4-methylbenzoyl)piperazin-1-yl]-[4-(2-methoxyethylamino)-3-nitrophenyl]methanone |
|---|---|
| PubChem CID | 55879029 |
| Molecular Formula | C22H25FN4O5 |
| Molecular Weight | 444.46 g/mol |
| Exact Mass | 444.18 |
| IUPAC Name | [4-(3-fluoro-4-methylbenzoyl)piperazin-1-yl]-[4-(2-methoxyethylamino)-3-nitrophenyl]methanone |
| SMILES | COCCNc1ccc(C(=O)N2CCN(C(=O)c3ccc(C)c(F)c3)CC2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C22H25FN4O5/c1-15-3-4-16(13-18(15)23)21(28)25-8-10-26(11-9-25)22(29)17-5-6-19(24-7-12-32-2)20(14-17)27(30)31/h3-6,13-14,24H,7-12H2,1-2H3 |
| InChIKey | CVFVRVRCIJJZHO-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 105.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.46 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|