C17H19N5O3 — CID 75431404
1-[4-(4-methyl-5-nitro-2-pyridinyl)piperazin-1-yl]-2-pyridin-2-ylethanone (PubChem CID 75431404) has the molecular formula C17H19N5O3 and a molecular weight of 341.37 g/mol. Its IUPAC name is 1-[4-(4-methyl-5-nitro-2-pyridinyl)piperazin-1-yl]-2-pyridin-2-ylethanone.
| Compound Name | 1-[4-(4-methyl-5-nitro-2-pyridinyl)piperazin-1-yl]-2-pyridin-2-ylethanone |
|---|---|
| PubChem CID | 75431404 |
| Molecular Formula | C17H19N5O3 |
| Molecular Weight | 341.37 g/mol |
| Exact Mass | 341.15 |
| IUPAC Name | 1-[4-(4-methyl-5-nitro-2-pyridinyl)piperazin-1-yl]-2-pyridin-2-ylethanone |
| SMILES | Cc1cc(N2CCN(C(=O)Cc3ccccn3)CC2)ncc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H19N5O3/c1-13-10-16(19-12-15(13)22(24)25)20-6-8-21(9-7-20)17(23)11-14-4-2-3-5-18-14/h2-5,10,12H,6-9,11H2,1H3 |
| InChIKey | ZZSOFOUPRXTZMW-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 92.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.37 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|