C28H35N3O6S — CID 54211309
tert-butyl 2-(hydroxymethyl)-4-[3-[3-nitro-4-(2-propan-2-ylphenyl)sulfanylphenyl]prop-2-enoyl]piperazine-1-carboxylate (PubChem CID 54211309) has the molecular formula C28H35N3O6S and a molecular weight of 541.67 g/mol. Its IUPAC name is tert-butyl 2-(hydroxymethyl)-4-[3-[3-nitro-4-(2-propan-2-ylphenyl)sulfanylphenyl]prop-2-enoyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 2-(hydroxymethyl)-4-[3-[3-nitro-4-(2-propan-2-ylphenyl)sulfanylphenyl]prop-2-enoyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 54211309 |
| Molecular Formula | C28H35N3O6S |
| Molecular Weight | 541.67 g/mol |
| Exact Mass | 541.22 |
| IUPAC Name | tert-butyl 2-(hydroxymethyl)-4-[3-[3-nitro-4-(2-propan-2-ylphenyl)sulfanylphenyl]prop-2-enoyl]piperazine-1-carboxylate |
| SMILES | CC(C)c1ccccc1Sc1ccc(C=CC(=O)N2CCN(C(=O)OC(C)(C)C)C(CO)C2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C28H35N3O6S/c1-19(2)22-8-6-7-9-24(22)38-25-12-10-20(16-23(25)31(35)36)11-13-26(33)29-14-15-30(21(17-29)18-32)27(34)37-28(3,4)5/h6-13,16,19,21,32H,14-15,17-18H2,1-5H3 |
| InChIKey | PWDJNUBOGPFZCV-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 113.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.67 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|