C25H24F3NO5S — CID 87955443
ethyl 1-[2-[4-(3,4-dihydro-1,2-benzodioxin-6-ylsulfanyl)-3-(trifluoromethyl)phenyl]prop-2-enoyl]pyrrolidine-3-carboxylate (PubChem CID 87955443) has the molecular formula C25H24F3NO5S and a molecular weight of 507.53 g/mol. Its IUPAC name is ethyl 1-[2-[4-(3,4-dihydro-1,2-benzodioxin-6-ylsulfanyl)-3-(trifluoromethyl)phenyl]prop-2-enoyl]pyrrolidine-3-carboxylate.
| Compound Name | ethyl 1-[2-[4-(3,4-dihydro-1,2-benzodioxin-6-ylsulfanyl)-3-(trifluoromethyl)phenyl]prop-2-enoyl]pyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 87955443 |
| Molecular Formula | C25H24F3NO5S |
| Molecular Weight | 507.53 g/mol |
| Exact Mass | 507.13 |
| IUPAC Name | ethyl 1-[2-[4-(3,4-dihydro-1,2-benzodioxin-6-ylsulfanyl)-3-(trifluoromethyl)phenyl]prop-2-enoyl]pyrrolidine-3-carboxylate |
| SMILES | C=C(C(=O)N1CCC(C(=O)OCC)C1)c1ccc(Sc2ccc3c(c2)CCOO3)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C25H24F3NO5S/c1-3-32-24(31)18-8-10-29(14-18)23(30)15(2)16-4-7-22(20(13-16)25(26,27)28)35-19-5-6-21-17(12-19)9-11-33-34-21/h4-7,12-13,18H,2-3,8-11,14H2,1H3 |
| InChIKey | OLMQRHHBTSRMNF-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.53 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|